C25H30O4S — CID 23833739
4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol (PubChem CID 23833739) has the molecular formula C25H30O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is 4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol.
| Compound Name | 4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 23833739 |
| Molecular Formula | C25H30O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]naphthalen-1-ol |
| SMILES | CC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OC[C@H]2C1=C(C(C)C)CS2(=O)=O |
| InChI | InChI=1S/C25H30O4S/c1-4-17(13-18-10-11-22(26)20-8-6-5-7-19(18)20)9-12-23-25-21(16(2)3)15-30(27,28)24(25)14-29-23/h5-8,10-11,13,16,23-24,26H,4,9,12,14-15H2,1-3H3/b17-13+/t23-,24+/m1/s1 |
| InChIKey | XBNRNFQEFCFRKL-HHBJCIJNSA-N |
| XLogP | 5.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|