C23H27BO4 — CID 23973784
[5-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]furan-2-yl]methanol (PubChem CID 23973784) has the molecular formula C23H27BO4 and a molecular weight of 378.28 g/mol. Its IUPAC name is [5-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]furan-2-yl]methanol.
| Compound Name | [5-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 23973784 |
| Molecular Formula | C23H27BO4 |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [5-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]furan-2-yl]methanol |
| SMILES | C=C(CC)C1=CCB(O)OC1CC/C(=C/c1ccc(CO)o1)c1ccccc1 |
| InChI | InChI=1S/C23H27BO4/c1-3-17(2)22-13-14-24(26)28-23(22)12-9-19(18-7-5-4-6-8-18)15-20-10-11-21(16-25)27-20/h4-8,10-11,13,15,23,25-26H,2-3,9,12,14,16H2,1H3/b19-15- |
| InChIKey | ZVUNYCHVBXEZGQ-CYVLTUHYSA-N |
| XLogP | 4.86 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|