C26H33ClO4 — CID 23946800
(2S,3R,4R,7E)-7-[(2-chloro-4-hydroxyphenyl)methylidene]-3-ethenyl-1-phenylmethoxydecane-2,4-diol (PubChem CID 23946800) has the molecular formula C26H33ClO4 and a molecular weight of 445.00 g/mol. Its IUPAC name is (2S,3R,4R,7E)-7-[(2-chloro-4-hydroxyphenyl)methylidene]-3-ethenyl-1-phenylmethoxydecane-2,4-diol.
| Compound Name | (2S,3R,4R,7E)-7-[(2-chloro-4-hydroxyphenyl)methylidene]-3-ethenyl-1-phenylmethoxydecane-2,4-diol |
|---|---|
| PubChem CID | 23946800 |
| Molecular Formula | C26H33ClO4 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (2S,3R,4R,7E)-7-[(2-chloro-4-hydroxyphenyl)methylidene]-3-ethenyl-1-phenylmethoxydecane-2,4-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(O)cc1Cl)CCC)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C26H33ClO4/c1-3-8-19(15-21-12-13-22(28)16-24(21)27)11-14-25(29)23(4-2)26(30)18-31-17-20-9-6-5-7-10-20/h4-7,9-10,12-13,15-16,23,25-26,28-30H,2-3,8,11,14,17-18H2,1H3/b19-15+/t23-,25-,26-/m1/s1 |
| InChIKey | PACXRSPRRHMJDT-FTFQISLUSA-N |
| XLogP | 5.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|