C15H24O2 — CID 11333834
3-(phenylmethoxymethyl)heptan-4-ol (PubChem CID 11333834) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-(phenylmethoxymethyl)heptan-4-ol.
| Compound Name | 3-(phenylmethoxymethyl)heptan-4-ol |
|---|---|
| PubChem CID | 11333834 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-(phenylmethoxymethyl)heptan-4-ol |
| SMILES | CCCC(O)C(CC)COCc1ccccc1 |
| InChI | InChI=1S/C15H24O2/c1-3-8-15(16)14(4-2)12-17-11-13-9-6-5-7-10-13/h5-7,9-10,14-16H,3-4,8,11-12H2,1-2H3 |
| InChIKey | CBHSDSKQKDGPKM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |