C14H20O3 — CID 174921830
3-(phenylmethoxymethyl)hexanoic acid (PubChem CID 174921830) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(phenylmethoxymethyl)hexanoic acid.
| Compound Name | 3-(phenylmethoxymethyl)hexanoic acid |
|---|---|
| PubChem CID | 174921830 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-(phenylmethoxymethyl)hexanoic acid |
| SMILES | CCCC(COCc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C14H20O3/c1-2-6-13(9-14(15)16)11-17-10-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3,(H,15,16) |
| InChIKey | PJHFDYWZLFZBEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |