C15H22O — CID 50898080
[(2S)-2-ethenylhexoxy]methylbenzene (PubChem CID 50898080) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is [(2S)-2-ethenylhexoxy]methylbenzene.
| Compound Name | [(2S)-2-ethenylhexoxy]methylbenzene |
|---|---|
| PubChem CID | 50898080 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | [(2S)-2-ethenylhexoxy]methylbenzene |
| SMILES | C=C[C@H](CCCC)COCc1ccccc1 |
| InChI | InChI=1S/C15H22O/c1-3-5-9-14(4-2)12-16-13-15-10-7-6-8-11-15/h4,6-8,10-11,14H,2-3,5,9,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | RKWGAPZOCGBNOK-CQSZACIVSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|