C17H22O2 — CID 101152485
(5R,6E)-5-(phenylmethoxymethyl)nona-6,8-dienal (PubChem CID 101152485) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (5R,6E)-5-(phenylmethoxymethyl)nona-6,8-dienal.
| Compound Name | (5R,6E)-5-(phenylmethoxymethyl)nona-6,8-dienal |
|---|---|
| PubChem CID | 101152485 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (5R,6E)-5-(phenylmethoxymethyl)nona-6,8-dienal |
| SMILES | C=C/C=C/[C@@H](CCCC=O)COCc1ccccc1 |
| InChI | InChI=1S/C17H22O2/c1-2-3-9-16(12-7-8-13-18)14-19-15-17-10-5-4-6-11-17/h2-6,9-11,13,16H,1,7-8,12,14-15H2/b9-3+/t16-/m0/s1 |
| InChIKey | NCVIHPSZKHWVPB-CFZDNBDDSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|