C27H29NO4 — CID 135671111
(Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)-6-pyridin-2-ylhept-6-ene-1,3-diol (PubChem CID 135671111) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)-6-pyridin-2-ylhept-6-ene-1,3-diol.
| Compound Name | (Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)-6-pyridin-2-ylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 135671111 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxyphenyl)-1-(4-methoxyphenyl)-6-pyridin-2-ylhept-6-ene-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(O)cc1)c1ccccn1)[C@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H29NO4/c1-3-24(27(31)20-9-14-23(32-2)15-10-20)26(30)16-11-21(25-6-4-5-17-28-25)18-19-7-12-22(29)13-8-19/h3-10,12-15,17-18,24,26-27,29-31H,1,11,16H2,2H3/b21-18-/t24-,26-,27-/m1/s1 |
| InChIKey | XTJVUQSMRSZRKI-CXNMRDHTSA-N |
| XLogP | 5.01 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|