C16H14ClNO — CID 173484560
2-[3-chloro-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]pyridine (PubChem CID 173484560) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-[3-chloro-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]pyridine.
| Compound Name | 2-[3-chloro-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 173484560 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[3-chloro-1-(4-methoxyphenyl)buta-1,3-dien-2-yl]pyridine |
| SMILES | C=C(Cl)C(=Cc1ccc(OC)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H14ClNO/c1-12(17)15(16-5-3-4-10-18-16)11-13-6-8-14(19-2)9-7-13/h3-11H,1H2,2H3 |
| InChIKey | SGJRFSKECRMXQS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|