C13H20O2 — CID 97293367
(1S)-1-(4-methoxy-3,5-dimethylphenyl)butan-1-ol (PubChem CID 97293367) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1S)-1-(4-methoxy-3,5-dimethylphenyl)butan-1-ol.
| Compound Name | (1S)-1-(4-methoxy-3,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 97293367 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1S)-1-(4-methoxy-3,5-dimethylphenyl)butan-1-ol |
| SMILES | CCC[C@H](O)c1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C13H20O2/c1-5-6-12(14)11-7-9(2)13(15-4)10(3)8-11/h7-8,12,14H,5-6H2,1-4H3/t12-/m0/s1 |
| InChIKey | FEYWMWWQOQAQGC-LBPRGKRZSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |