C11H17NO — CID 130560260
1-(5,6-dimethyl-3-pyridinyl)butan-1-ol (PubChem CID 130560260) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(5,6-dimethyl-3-pyridinyl)butan-1-ol.
| Compound Name | 1-(5,6-dimethyl-3-pyridinyl)butan-1-ol |
|---|---|
| PubChem CID | 130560260 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(5,6-dimethyl-3-pyridinyl)butan-1-ol |
| SMILES | CCCC(O)c1cnc(C)c(C)c1 |
| InChI | InChI=1S/C11H17NO/c1-4-5-11(13)10-6-8(2)9(3)12-7-10/h6-7,11,13H,4-5H2,1-3H3 |
| InChIKey | YSRNBMNHAKAWCP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |