C12H17ClO — CID 97293385
(1S)-1-(4-chloro-3,5-dimethylphenyl)butan-1-ol (PubChem CID 97293385) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is (1S)-1-(4-chloro-3,5-dimethylphenyl)butan-1-ol.
| Compound Name | (1S)-1-(4-chloro-3,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 97293385 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1S)-1-(4-chloro-3,5-dimethylphenyl)butan-1-ol |
| SMILES | CCC[C@H](O)c1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C12H17ClO/c1-4-5-11(14)10-6-8(2)12(13)9(3)7-10/h6-7,11,14H,4-5H2,1-3H3/t11-/m0/s1 |
| InChIKey | ISLQZZMYMOLPHJ-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |