C10H14ClNO — CID 84775613
2-amino-1-(4-chloro-3,5-dimethylphenyl)ethanol (PubChem CID 84775613) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-amino-1-(4-chloro-3,5-dimethylphenyl)ethanol.
| Compound Name | 2-amino-1-(4-chloro-3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 84775613 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-amino-1-(4-chloro-3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C(O)CN)cc(C)c1Cl |
| InChI | InChI=1S/C10H14ClNO/c1-6-3-8(9(13)5-12)4-7(2)10(6)11/h3-4,9,13H,5,12H2,1-2H3 |
| InChIKey | NXYHOQNTXXNTIP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |