C9H11ClFNO — CID 84671959
2-amino-1-(3-chloro-4-fluoro-5-methylphenyl)ethanol (PubChem CID 84671959) has the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. Its IUPAC name is 2-amino-1-(3-chloro-4-fluoro-5-methylphenyl)ethanol.
| Compound Name | 2-amino-1-(3-chloro-4-fluoro-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 84671959 |
| Molecular Formula | C9H11ClFNO |
| Molecular Weight | 203.64 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-amino-1-(3-chloro-4-fluoro-5-methylphenyl)ethanol |
| SMILES | Cc1cc(C(O)CN)cc(Cl)c1F |
| InChI | InChI=1S/C9H11ClFNO/c1-5-2-6(8(13)4-12)3-7(10)9(5)11/h2-3,8,13H,4,12H2,1H3 |
| InChIKey | QNFOYZGFQSQNTO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.64 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |