C12H15ClO — CID 91655528
1-(4-chloro-3,5-dimethylphenyl)but-3-en-1-ol (PubChem CID 91655528) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylphenyl)but-3-en-1-ol.
| Compound Name | 1-(4-chloro-3,5-dimethylphenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 91655528 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylphenyl)but-3-en-1-ol |
| SMILES | C=CCC(O)c1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C12H15ClO/c1-4-5-11(14)10-6-8(2)12(13)9(3)7-10/h4,6-7,11,14H,1,5H2,2-3H3 |
| InChIKey | JIRVVZCPLXPMPC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|