C22H24ClNO5 — CID 23834674
(E,1S,2R,3R)-7-(2-chloro-4-hydroxyphenyl)-2-ethenyl-6-methyl-1-(4-nitrophenyl)hept-6-ene-1,3-diol (PubChem CID 23834674) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is (E,1S,2R,3R)-7-(2-chloro-4-hydroxyphenyl)-2-ethenyl-6-methyl-1-(4-nitrophenyl)hept-6-ene-1,3-diol.
| Compound Name | (E,1S,2R,3R)-7-(2-chloro-4-hydroxyphenyl)-2-ethenyl-6-methyl-1-(4-nitrophenyl)hept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 23834674 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E,1S,2R,3R)-7-(2-chloro-4-hydroxyphenyl)-2-ethenyl-6-methyl-1-(4-nitrophenyl)hept-6-ene-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(C)=C/c1ccc(O)cc1Cl)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24ClNO5/c1-3-19(22(27)15-5-8-17(9-6-15)24(28)29)21(26)11-4-14(2)12-16-7-10-18(25)13-20(16)23/h3,5-10,12-13,19,21-22,25-27H,1,4,11H2,2H3/b14-12+/t19-,21-,22-/m1/s1 |
| InChIKey | KVSLDURSJPYLMS-CBVBUBJSSA-N |
| XLogP | 5.03 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|