C14H18O2 — CID 144756444
2-methylpropane;naphthalene-1,4-diol (PubChem CID 144756444) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-methylpropane;naphthalene-1,4-diol.
| Compound Name | 2-methylpropane;naphthalene-1,4-diol |
|---|---|
| PubChem CID | 144756444 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-methylpropane;naphthalene-1,4-diol |
| SMILES | CC(C)C.Oc1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C10H8O2.C4H10/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-4(2)3/h1-6,11-12H;4H,1-3H3 |
| InChIKey | CXUGWQDBHYXDFC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|