About 4-bromonaphthalen-1-ol
4-bromonaphthalen-1-ol (PubChem CID 575609) has the molecular formula C10H7BrO
and a molecular weight of 223.07 g/mol. Its IUPAC name is 4-bromonaphthalen-1-ol.
Molecular Properties
| Compound Name | 4-bromonaphthalen-1-ol |
| PubChem CID | 575609 |
| Molecular Formula | C10H7BrO |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 4-bromonaphthalen-1-ol |
| SMILES | Oc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C10H7BrO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
| InChIKey | OUNQUWORSXHSJN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromonaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromonaphthalen-1-ol?
The IUPAC name of 4-bromonaphthalen-1-ol (CID 575609) is 4-bromonaphthalen-1-ol.
What is the SMILES notation for 4-bromonaphthalen-1-ol?
The canonical SMILES for 4-bromonaphthalen-1-ol is Oc1ccc(Br)c2ccccc12.
What is the InChIKey of 4-bromonaphthalen-1-ol?
The InChIKey is OUNQUWORSXHSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H.
What are the key properties of 4-bromonaphthalen-1-ol?
4-bromonaphthalen-1-ol has a molecular weight of 223.07 g/mol, XLogP of 3.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromonaphthalen-1-ol is sourced from PubChem (CID 575609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).