C15H16O3S — CID 112595969
2-(4-hydroxynaphthalen-1-yl)sulfanyl-3-methylbutanoic acid (PubChem CID 112595969) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(4-hydroxynaphthalen-1-yl)sulfanyl-3-methylbutanoic acid.
| Compound Name | 2-(4-hydroxynaphthalen-1-yl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 112595969 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-(4-hydroxynaphthalen-1-yl)sulfanyl-3-methylbutanoic acid |
| SMILES | CC(C)C(Sc1ccc(O)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H16O3S/c1-9(2)14(15(17)18)19-13-8-7-12(16)10-5-3-4-6-11(10)13/h3-9,14,16H,1-2H3,(H,17,18) |
| InChIKey | QZEOTSLMZSGUEN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |