C15H15N3O2S — CID 167970693
3-methyl-2-(9H-pyrimido[4,5-b]indol-4-ylsulfanyl)butanoic acid (PubChem CID 167970693) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-methyl-2-(9H-pyrimido[4,5-b]indol-4-ylsulfanyl)butanoic acid.
| Compound Name | 3-methyl-2-(9H-pyrimido[4,5-b]indol-4-ylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 167970693 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-methyl-2-(9H-pyrimido[4,5-b]indol-4-ylsulfanyl)butanoic acid |
| SMILES | CC(C)C(Sc1ncnc2[nH]c3ccccc3c12)C(=O)O |
| InChI | InChI=1S/C15H15N3O2S/c1-8(2)12(15(19)20)21-14-11-9-5-3-4-6-10(9)18-13(11)16-7-17-14/h3-8,12H,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | AFRQAOXSDHYUER-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |