C17H16N4O4 — CID 167892957
1-(9H-pyrimido[4,5-b]indol-4-yl)piperidine-3,5-dicarboxylic acid (PubChem CID 167892957) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 1-(9H-pyrimido[4,5-b]indol-4-yl)piperidine-3,5-dicarboxylic acid.
| Compound Name | 1-(9H-pyrimido[4,5-b]indol-4-yl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 167892957 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(9H-pyrimido[4,5-b]indol-4-yl)piperidine-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)O)CN(c2ncnc3[nH]c4ccccc4c23)C1 |
| InChI | InChI=1S/C17H16N4O4/c22-16(23)9-5-10(17(24)25)7-21(6-9)15-13-11-3-1-2-4-12(11)20-14(13)18-8-19-15/h1-4,8-10H,5-7H2,(H,22,23)(H,24,25)(H,18,19,20) |
| InChIKey | VKICITZMKVUURU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |