C16H18N4O — CID 167879751
4-methyl-1-(9H-pyrimido[4,5-b]indol-4-yl)piperidin-3-ol (PubChem CID 167879751) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-methyl-1-(9H-pyrimido[4,5-b]indol-4-yl)piperidin-3-ol.
| Compound Name | 4-methyl-1-(9H-pyrimido[4,5-b]indol-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 167879751 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-methyl-1-(9H-pyrimido[4,5-b]indol-4-yl)piperidin-3-ol |
| SMILES | CC1CCN(c2ncnc3[nH]c4ccccc4c23)CC1O |
| InChI | InChI=1S/C16H18N4O/c1-10-6-7-20(8-13(10)21)16-14-11-4-2-3-5-12(11)19-15(14)17-9-18-16/h2-5,9-10,13,21H,6-8H2,1H3,(H,17,18,19) |
| InChIKey | GVIVDUSQOWBBHC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |