C17H20N4 — CID 930329
4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole (PubChem CID 930329) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole.
| Compound Name | 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 930329 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2ncnc3c2[nH]c2ccccc23)C1 |
| InChI | InChI=1S/C17H20N4/c1-11-7-12(2)9-21(8-11)17-16-15(18-10-19-17)13-5-3-4-6-14(13)20-16/h3-6,10-12,20H,7-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | BAGPADIMSAEOGA-VXGBXAGGSA-N |
| XLogP | 3.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |