C16H17BrN4 — CID 921248
8-bromo-4-[(3S)-3-methylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole (PubChem CID 921248) has the molecular formula C16H17BrN4 and a molecular weight of 345.24 g/mol. Its IUPAC name is 8-bromo-4-[(3S)-3-methylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole.
| Compound Name | 8-bromo-4-[(3S)-3-methylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 921248 |
| Molecular Formula | C16H17BrN4 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 8-bromo-4-[(3S)-3-methylpiperidin-1-yl]-5H-pyrimido[5,4-b]indole |
| SMILES | C[C@H]1CCCN(c2ncnc3c2[nH]c2ccc(Br)cc23)C1 |
| InChI | InChI=1S/C16H17BrN4/c1-10-3-2-6-21(8-10)16-15-14(18-9-19-16)12-7-11(17)4-5-13(12)20-15/h4-5,7,9-10,20H,2-3,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | AICUOFFLXFLZMX-JTQLQIEISA-N |
| XLogP | 4.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |