C15H16BrN5 — CID 3846847
8-bromo-4-(4-methylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole (PubChem CID 3846847) has the molecular formula C15H16BrN5 and a molecular weight of 346.23 g/mol. Its IUPAC name is 8-bromo-4-(4-methylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole.
| Compound Name | 8-bromo-4-(4-methylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 3846847 |
| Molecular Formula | C15H16BrN5 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 8-bromo-4-(4-methylpiperazin-1-yl)-5H-pyrimido[5,4-b]indole |
| SMILES | CN1CCN(c2ncnc3c2[nH]c2ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C15H16BrN5/c1-20-4-6-21(7-5-20)15-14-13(17-9-18-15)11-8-10(16)2-3-12(11)19-14/h2-3,8-9,19H,4-7H2,1H3 |
| InChIKey | GKJGIVJSYGSDDG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |