C20H17ClFN5 — CID 3798373
8-chloro-4-[4-(2-fluorophenyl)piperazin-1-yl]-5H-pyrimido[5,4-b]indole (PubChem CID 3798373) has the molecular formula C20H17ClFN5 and a molecular weight of 381.84 g/mol. Its IUPAC name is 8-chloro-4-[4-(2-fluorophenyl)piperazin-1-yl]-5H-pyrimido[5,4-b]indole.
| Compound Name | 8-chloro-4-[4-(2-fluorophenyl)piperazin-1-yl]-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 3798373 |
| Molecular Formula | C20H17ClFN5 |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 8-chloro-4-[4-(2-fluorophenyl)piperazin-1-yl]-5H-pyrimido[5,4-b]indole |
| SMILES | Fc1ccccc1N1CCN(c2ncnc3c2[nH]c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C20H17ClFN5/c21-13-5-6-16-14(11-13)18-19(25-16)20(24-12-23-18)27-9-7-26(8-10-27)17-4-2-1-3-15(17)22/h1-6,11-12,25H,7-10H2 |
| InChIKey | URGPUDPJXLWPOR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |