C24H27F2N7 — CID 19153662
4,6-bis[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine (PubChem CID 19153662) has the molecular formula C24H27F2N7 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4,6-bis[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine.
| Compound Name | 4,6-bis[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 19153662 |
| Molecular Formula | C24H27F2N7 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 4,6-bis[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine |
| SMILES | Nc1c(N2CCN(c3ccccc3F)CC2)ncnc1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H27F2N7/c25-18-5-1-3-7-20(18)30-9-13-32(14-10-30)23-22(27)24(29-17-28-23)33-15-11-31(12-16-33)21-8-4-2-6-19(21)26/h1-8,17H,9-16,27H2 |
| InChIKey | OBSGAUOZKMCGII-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |