C16H22FN7 — CID 19145631
4-(2,2-dimethylhydrazinyl)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine (PubChem CID 19145631) has the molecular formula C16H22FN7 and a molecular weight of 331.40 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 19145631 |
| Molecular Formula | C16H22FN7 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine |
| SMILES | CN(C)Nc1ncnc(N2CCN(c3ccccc3F)CC2)c1N |
| InChI | InChI=1S/C16H22FN7/c1-22(2)21-15-14(18)16(20-11-19-15)24-9-7-23(8-10-24)13-6-4-3-5-12(13)17/h3-6,11H,7-10,18H2,1-2H3,(H,19,20,21) |
| InChIKey | RFDIKKNTPAGQEC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|