C20H21FN6 — CID 19138559
4-N-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine (PubChem CID 19138559) has the molecular formula C20H21FN6 and a molecular weight of 364.43 g/mol. Its IUPAC name is 4-N-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19138559 |
| Molecular Formula | C20H21FN6 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-N-(2-fluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccccc2F)ncnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21FN6/c21-16-8-4-5-9-17(16)25-19-18(22)20(24-14-23-19)27-12-10-26(11-13-27)15-6-2-1-3-7-15/h1-9,14H,10-13,22H2,(H,23,24,25) |
| InChIKey | UYFILSGKWZUAAU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |