C21H22N6O2 — CID 19138679
4-[[5-amino-6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 19138679) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 4-[[5-amino-6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 19138679 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[[5-amino-6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Nc1c(Nc2ccc(C(=O)O)cc2)ncnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N6O2/c22-18-19(25-16-8-6-15(7-9-16)21(28)29)23-14-24-20(18)27-12-10-26(11-13-27)17-4-2-1-3-5-17/h1-9,14H,10-13,22H2,(H,28,29)(H,23,24,25) |
| InChIKey | HBIUVKTUIJFHHA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |