C20H22FN7 — CID 19144398
4-[4-(2-fluorophenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine (PubChem CID 19144398) has the molecular formula C20H22FN7 and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-[4-(2-fluorophenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine.
| Compound Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19144398 |
| Molecular Formula | C20H22FN7 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-6-(2-phenylhydrazinyl)pyrimidin-5-amine |
| SMILES | Nc1c(NNc2ccccc2)ncnc1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H22FN7/c21-16-8-4-5-9-17(16)27-10-12-28(13-11-27)20-18(22)19(23-14-24-20)26-25-15-6-2-1-3-7-15/h1-9,14,25H,10-13,22H2,(H,23,24,26) |
| InChIKey | VOFKRGMBPSEAKC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|