C18H22N4 — CID 40540340
5,8-dimethyl-4-[(3S)-3-methylpiperidin-1-yl]pyrimido[5,4-b]indole (PubChem CID 40540340) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 5,8-dimethyl-4-[(3S)-3-methylpiperidin-1-yl]pyrimido[5,4-b]indole.
| Compound Name | 5,8-dimethyl-4-[(3S)-3-methylpiperidin-1-yl]pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 40540340 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5,8-dimethyl-4-[(3S)-3-methylpiperidin-1-yl]pyrimido[5,4-b]indole |
| SMILES | Cc1ccc2c(c1)c1ncnc(N3CCC[C@H](C)C3)c1n2C |
| InChI | InChI=1S/C18H22N4/c1-12-6-7-15-14(9-12)16-17(21(15)3)18(20-11-19-16)22-8-4-5-13(2)10-22/h6-7,9,11,13H,4-5,8,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | ZJPYKGTWLHTNEA-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |