C16H21N3S — CID 133395119
6-methyl-4-(3-methylsulfanylazepan-1-yl)quinazoline (PubChem CID 133395119) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 6-methyl-4-(3-methylsulfanylazepan-1-yl)quinazoline.
| Compound Name | 6-methyl-4-(3-methylsulfanylazepan-1-yl)quinazoline |
|---|---|
| PubChem CID | 133395119 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 6-methyl-4-(3-methylsulfanylazepan-1-yl)quinazoline |
| SMILES | CSC1CCCCN(c2ncnc3ccc(C)cc23)C1 |
| InChI | InChI=1S/C16H21N3S/c1-12-6-7-15-14(9-12)16(18-11-17-15)19-8-4-3-5-13(10-19)20-2/h6-7,9,11,13H,3-5,8,10H2,1-2H3 |
| InChIKey | SQYMJMNTEBZOHS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |