C12H17N5S — CID 133395111
4-(3-methylsulfanylazepan-1-yl)-1H-pyrazolo[5,4-d]pyrimidine (PubChem CID 133395111) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-(3-methylsulfanylazepan-1-yl)-1H-pyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-(3-methylsulfanylazepan-1-yl)-1H-pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 133395111 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-(3-methylsulfanylazepan-1-yl)-1H-pyrazolo[5,4-d]pyrimidine |
| SMILES | CSC1CCCCN(c2ncnc3[nH]ncc23)C1 |
| InChI | InChI=1S/C12H17N5S/c1-18-9-4-2-3-5-17(7-9)12-10-6-15-16-11(10)13-8-14-12/h6,8-9H,2-5,7H2,1H3,(H,13,14,15,16) |
| InChIKey | HVWKYDOKAQUDQJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |