C18H21N5 — CID 133300671
6-methyl-4-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]quinazoline (PubChem CID 133300671) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 6-methyl-4-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]quinazoline.
| Compound Name | 6-methyl-4-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 133300671 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-methyl-4-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]quinazoline |
| SMILES | Cc1ccc2ncnc(N3CCC(c4cnn(C)c4)CC3)c2c1 |
| InChI | InChI=1S/C18H21N5/c1-13-3-4-17-16(9-13)18(20-12-19-17)23-7-5-14(6-8-23)15-10-21-22(2)11-15/h3-4,9-12,14H,5-8H2,1-2H3 |
| InChIKey | ZYNMFGRMRZKTPD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |