C21H24N4 — CID 112843750
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylquinazoline (PubChem CID 112843750) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylquinazoline.
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylquinazoline |
|---|---|
| PubChem CID | 112843750 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]-6-methylquinazoline |
| SMILES | Cc1ccc2ncnc(N3CCN(c4cccc(C)c4C)CC3)c2c1 |
| InChI | InChI=1S/C21H24N4/c1-15-7-8-19-18(13-15)21(23-14-22-19)25-11-9-24(10-12-25)20-6-4-5-16(2)17(20)3/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | LYBQXYSXMILTBT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |