C21H23ClN4 — CID 112843812
4-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]-6-methylquinazoline (PubChem CID 112843812) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]-6-methylquinazoline.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]-6-methylquinazoline |
|---|---|
| PubChem CID | 112843812 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]-6-methylquinazoline |
| SMILES | Cc1ccc2ncnc(N3CCCN(Cc4ccc(Cl)cc4)CC3)c2c1 |
| InChI | InChI=1S/C21H23ClN4/c1-16-3-8-20-19(13-16)21(24-15-23-20)26-10-2-9-25(11-12-26)14-17-4-6-18(22)7-5-17/h3-8,13,15H,2,9-12,14H2,1H3 |
| InChIKey | SQUNCKGPWITMGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |