C17H18N6O — CID 133336905
1-(1-methylpyrazol-4-yl)-4-(6-methylquinazolin-4-yl)piperazin-2-one (PubChem CID 133336905) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-4-(6-methylquinazolin-4-yl)piperazin-2-one.
| Compound Name | 1-(1-methylpyrazol-4-yl)-4-(6-methylquinazolin-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 133336905 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-4-(6-methylquinazolin-4-yl)piperazin-2-one |
| SMILES | Cc1ccc2ncnc(N3CCN(c4cnn(C)c4)C(=O)C3)c2c1 |
| InChI | InChI=1S/C17H18N6O/c1-12-3-4-15-14(7-12)17(19-11-18-15)22-5-6-23(16(24)10-22)13-8-20-21(2)9-13/h3-4,7-9,11H,5-6,10H2,1-2H3 |
| InChIKey | DJKKOJXJLWQPJO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |