C13H14N8O — CID 133336935
1-(1-methylpyrazol-4-yl)-4-(7H-purin-6-yl)piperazin-2-one (PubChem CID 133336935) has the molecular formula C13H14N8O and a molecular weight of 298.31 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-4-(7H-purin-6-yl)piperazin-2-one.
| Compound Name | 1-(1-methylpyrazol-4-yl)-4-(7H-purin-6-yl)piperazin-2-one |
|---|---|
| PubChem CID | 133336935 |
| Molecular Formula | C13H14N8O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-4-(7H-purin-6-yl)piperazin-2-one |
| SMILES | Cn1cc(N2CCN(c3ncnc4nc[nH]c34)CC2=O)cn1 |
| InChI | InChI=1S/C13H14N8O/c1-19-5-9(4-18-19)21-3-2-20(6-10(21)22)13-11-12(15-7-14-11)16-8-17-13/h4-5,7-8H,2-3,6H2,1H3,(H,14,15,16,17) |
| InChIKey | WSFLBKVDNGVUGB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |