C14H19ClN6 — CID 133464294
4-chloro-N-methyl-6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrimidin-5-amine (PubChem CID 133464294) has the molecular formula C14H19ClN6 and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-chloro-N-methyl-6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-chloro-N-methyl-6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 133464294 |
| Molecular Formula | C14H19ClN6 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-chloro-N-methyl-6-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]pyrimidin-5-amine |
| SMILES | CNc1c(Cl)ncnc1N1CCC(c2cnn(C)c2)CC1 |
| InChI | InChI=1S/C14H19ClN6/c1-16-12-13(15)17-9-18-14(12)21-5-3-10(4-6-21)11-7-19-20(2)8-11/h7-10,16H,3-6H2,1-2H3 |
| InChIKey | UJWVVLSXXJXPQT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |