C10H15FN4 — CID 138511335
5-fluoro-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-4-amine (PubChem CID 138511335) has the molecular formula C10H15FN4 and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-fluoro-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-4-amine.
| Compound Name | 5-fluoro-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 138511335 |
| Molecular Formula | C10H15FN4 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-fluoro-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-4-amine |
| SMILES | C[C@@H]1CCCN(c2ncnc(N)c2F)C1 |
| InChI | InChI=1S/C10H15FN4/c1-7-3-2-4-15(5-7)10-8(11)9(12)13-6-14-10/h6-7H,2-5H2,1H3,(H2,12,13,14)/t7-/m1/s1 |
| InChIKey | KELRYFODPDYLAA-SSDOTTSWSA-N |
| XLogP | 1.43 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |