C9H14FN5O — CID 123328215
3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-ol (PubChem CID 123328215) has the molecular formula C9H14FN5O and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-ol.
| Compound Name | 3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 123328215 |
| Molecular Formula | C9H14FN5O |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-amino-1-(6-amino-5-fluoropyrimidin-4-yl)piperidin-4-ol |
| SMILES | Nc1ncnc(N2CCC(O)C(N)C2)c1F |
| InChI | InChI=1S/C9H14FN5O/c10-7-8(12)13-4-14-9(7)15-2-1-6(16)5(11)3-15/h4-6,16H,1-3,11H2,(H2,12,13,14) |
| InChIKey | XUJCMWDEGYKSAY-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |