C9H13ClFN5O — CID 123218553
1-(6-amino-5-fluoropyrimidin-4-yl)-3-(chloroamino)piperidin-4-ol (PubChem CID 123218553) has the molecular formula C9H13ClFN5O and a molecular weight of 261.69 g/mol. Its IUPAC name is 1-(6-amino-5-fluoropyrimidin-4-yl)-3-(chloroamino)piperidin-4-ol.
| Compound Name | 1-(6-amino-5-fluoropyrimidin-4-yl)-3-(chloroamino)piperidin-4-ol |
|---|---|
| PubChem CID | 123218553 |
| Molecular Formula | C9H13ClFN5O |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-(6-amino-5-fluoropyrimidin-4-yl)-3-(chloroamino)piperidin-4-ol |
| SMILES | Nc1ncnc(N2CCC(O)C(NCl)C2)c1F |
| InChI | InChI=1S/C9H13ClFN5O/c10-15-5-3-16(2-1-6(5)17)9-7(11)8(12)13-4-14-9/h4-6,15,17H,1-3H2,(H2,12,13,14) |
| InChIKey | BGKSHGVKMOKWCS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|