C9H15FN5O+ — CID 149288426
[1-(6-amino-5-fluoropyrimidin-4-yl)-4-hydroxypiperidin-3-yl]azanium (PubChem CID 149288426) has the molecular formula C9H15FN5O+ and a molecular weight of 228.25 g/mol. Its IUPAC name is [1-(6-amino-5-fluoropyrimidin-4-yl)-4-hydroxypiperidin-3-yl]azanium.
| Compound Name | [1-(6-amino-5-fluoropyrimidin-4-yl)-4-hydroxypiperidin-3-yl]azanium |
|---|---|
| PubChem CID | 149288426 |
| Molecular Formula | C9H15FN5O+ |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [1-(6-amino-5-fluoropyrimidin-4-yl)-4-hydroxypiperidin-3-yl]azanium |
| SMILES | Nc1ncnc(N2CCC(O)C([NH3+])C2)c1F |
| InChI | InChI=1S/C9H14FN5O/c10-7-8(12)13-4-14-9(7)15-2-1-6(16)5(11)3-15/h4-6,16H,1-3,11H2,(H2,12,13,14)/p+1 |
| InChIKey | XUJCMWDEGYKSAY-UHFFFAOYSA-O |
| XLogP | -1.62 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |