C11H8N4O2 — CID 175364145
4-amino-9H-pyrimido[4,5-b]indole-7-carboxylic acid (PubChem CID 175364145) has the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 4-amino-9H-pyrimido[4,5-b]indole-7-carboxylic acid.
| Compound Name | 4-amino-9H-pyrimido[4,5-b]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 175364145 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-amino-9H-pyrimido[4,5-b]indole-7-carboxylic acid |
| SMILES | Nc1ncnc2[nH]c3cc(C(=O)O)ccc3c12 |
| InChI | InChI=1S/C11H8N4O2/c12-9-8-6-2-1-5(11(16)17)3-7(6)15-10(8)14-4-13-9/h1-4H,(H,16,17)(H3,12,13,14,15) |
| InChIKey | LCPLJLVPJJYWNF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |