C20H22N6O2 — CID 137253896
methyl 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-methyl-1H-indole-6-carboxylate (PubChem CID 137253896) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is methyl 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-methyl-1H-indole-6-carboxylate.
| Compound Name | methyl 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-methyl-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 137253896 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | methyl 2-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-3-methyl-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C)c(-c3nn(C(C)(C)C)c4ncnc(N)c34)[nH]c2c1 |
| InChI | InChI=1S/C20H22N6O2/c1-10-12-7-6-11(19(27)28-5)8-13(12)24-15(10)16-14-17(21)22-9-23-18(14)26(25-16)20(2,3)4/h6-9,24H,1-5H3,(H2,21,22,23) |
| InChIKey | OSWOZPOSUMZWSC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|