C15H18N4O2S — CID 7144979
(2S)-N-carbamoyl-3-methyl-2-(2-methylquinazolin-4-yl)sulfanylbutanamide (PubChem CID 7144979) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is (2S)-N-carbamoyl-3-methyl-2-(2-methylquinazolin-4-yl)sulfanylbutanamide.
| Compound Name | (2S)-N-carbamoyl-3-methyl-2-(2-methylquinazolin-4-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 7144979 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (2S)-N-carbamoyl-3-methyl-2-(2-methylquinazolin-4-yl)sulfanylbutanamide |
| SMILES | Cc1nc(S[C@H](C(=O)NC(N)=O)C(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C15H18N4O2S/c1-8(2)12(13(20)19-15(16)21)22-14-10-6-4-5-7-11(10)17-9(3)18-14/h4-8,12H,1-3H3,(H3,16,19,20,21)/t12-/m0/s1 |
| InChIKey | WNIYABWOCHANJT-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |