C16H19N3O2S — CID 41328404
(2R)-N-carbamoyl-3-methyl-2-(4-methylquinolin-2-yl)sulfanylbutanamide (PubChem CID 41328404) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is (2R)-N-carbamoyl-3-methyl-2-(4-methylquinolin-2-yl)sulfanylbutanamide.
| Compound Name | (2R)-N-carbamoyl-3-methyl-2-(4-methylquinolin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41328404 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (2R)-N-carbamoyl-3-methyl-2-(4-methylquinolin-2-yl)sulfanylbutanamide |
| SMILES | Cc1cc(S[C@@H](C(=O)NC(N)=O)C(C)C)nc2ccccc12 |
| InChI | InChI=1S/C16H19N3O2S/c1-9(2)14(15(20)19-16(17)21)22-13-8-10(3)11-6-4-5-7-12(11)18-13/h4-9,14H,1-3H3,(H3,17,19,20,21)/t14-/m1/s1 |
| InChIKey | NPTISBXYDNMKOL-CQSZACIVSA-N |
| XLogP | 2.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |