C20H19FN4O3S — CID 7438596
(2S)-N-carbamoyl-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide (PubChem CID 7438596) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide.
| Compound Name | (2S)-N-carbamoyl-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 7438596 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (2S)-N-carbamoyl-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-3-methylbutanamide |
| SMILES | CC(C)[C@H](Sc1nc2ccccc2c(=O)n1-c1ccccc1F)C(=O)NC(N)=O |
| InChI | InChI=1S/C20H19FN4O3S/c1-11(2)16(17(26)24-19(22)28)29-20-23-14-9-5-3-7-12(14)18(27)25(20)15-10-6-4-8-13(15)21/h3-11,16H,1-2H3,(H3,22,24,26,28)/t16-/m0/s1 |
| InChIKey | FXLNXUSUPOGUIJ-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |