C22H24FN3O3S — CID 55526065
N-(3-ethoxypropyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 55526065) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-(3-ethoxypropyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55526065 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | CCOCCCNC(=O)C(C)Sc1nc2ccccc2c(=O)n1-c1ccccc1F |
| InChI | InChI=1S/C22H24FN3O3S/c1-3-29-14-8-13-24-20(27)15(2)30-22-25-18-11-6-4-9-16(18)21(28)26(22)19-12-7-5-10-17(19)23/h4-7,9-12,15H,3,8,13-14H2,1-2H3,(H,24,27) |
| InChIKey | LQDFEAUBVLOFBT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|